C22H23F3N4O — CID 9436914
(2S)-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 9436914) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is (2S)-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 9436914 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2S)-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN(C)[C@@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H23F3N4O/c1-13-17(14(2)29(27-13)16-8-6-5-7-9-16)12-28(4)15(3)22(30)26-19-11-10-18(23)20(24)21(19)25/h5-11,15H,12H2,1-4H3,(H,26,30)/t15-/m0/s1 |
| InChIKey | MEQVEYCFTYDJOT-HNNXBMFYSA-N |
| XLogP | 4.37 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|