C19H24N4O — CID 78842642
2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-N-prop-2-ynylpropanamide (PubChem CID 78842642) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 78842642 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)N(C)Cc1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C19H24N4O/c1-6-12-20-19(24)16(4)22(5)13-18-14(2)21-23(15(18)3)17-10-8-7-9-11-17/h1,7-11,16H,12-13H2,2-5H3,(H,20,24) |
| InChIKey | IXLKFKHXKZGEEE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|