C21H24N4O — CID 27533724
3-benzyl-1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1-methylurea (PubChem CID 27533724) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-benzyl-1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1-methylurea.
| Compound Name | 3-benzyl-1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 27533724 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-benzyl-1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1-methylurea |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN(C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H24N4O/c1-16-20(17(2)25(23-16)19-12-8-5-9-13-19)15-24(3)21(26)22-14-18-10-6-4-7-11-18/h4-13H,14-15H2,1-3H3,(H,22,26) |
| InChIKey | BOYGWBKDPMMJSH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |