C20H17F3N4O4 — CID 26660566
2-[[2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 26660566) has the molecular formula C20H17F3N4O4 and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-[[2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 26660566 |
| Molecular Formula | C20H17F3N4O4 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[[2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)c1=O |
| InChI | InChI=1S/C20H17F3N4O4/c1-2-26-19(30)11-5-3-4-6-14(11)27(20(26)31)10-16(29)24-9-15(28)25-13-8-7-12(21)17(22)18(13)23/h3-8H,2,9-10H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | BDTRUNJWDUVAQO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|