C19H18N4O5 — CID 26737786
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 26737786) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 26737786 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)Nc2cccc([N+](=O)[O-])c2C)c1=O |
| InChI | InChI=1S/C19H18N4O5/c1-3-21-18(25)13-7-4-5-9-16(13)22(19(21)26)11-17(24)20-14-8-6-10-15(12(14)2)23(27)28/h4-10H,3,11H2,1-2H3,(H,20,24) |
| InChIKey | URPBSPCLQJNBET-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|