C22H20N6O5 — CID 55503074
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]acetamide (PubChem CID 55503074) has the molecular formula C22H20N6O5 and a molecular weight of 448.44 g/mol. Its IUPAC name is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]acetamide.
| Compound Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 55503074 |
| Molecular Formula | C22H20N6O5 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]acetamide |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)Nc2cc(C)nn2-c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C22H20N6O5/c1-3-25-21(30)17-6-4-5-7-18(17)26(22(25)31)13-20(29)23-19-12-14(2)24-27(19)15-8-10-16(11-9-15)28(32)33/h4-12H,3,13H2,1-2H3,(H,23,29) |
| InChIKey | ITSAGHPLNUSBTH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|