C15H17N3O3 — CID 9400092
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-prop-2-enylacetamide (PubChem CID 9400092) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 9400092 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cn1c(=O)n(CC)c(=O)c2ccccc21 |
| InChI | InChI=1S/C15H17N3O3/c1-3-9-16-13(19)10-18-12-8-6-5-7-11(12)14(20)17(4-2)15(18)21/h3,5-8H,1,4,9-10H2,2H3,(H,16,19) |
| InChIKey | OKINQMHVPMJTEG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|