C19H18F3NO6 — CID 7758496
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2,3,4-trimethoxybenzoate (PubChem CID 7758496) has the molecular formula C19H18F3NO6 and a molecular weight of 413.35 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2,3,4-trimethoxybenzoate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 7758496 |
| Molecular Formula | C19H18F3NO6 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H](C)C(=O)Nc2ccc(F)c(F)c2F)c(OC)c1OC |
| InChI | InChI=1S/C19H18F3NO6/c1-9(18(24)23-12-7-6-11(20)14(21)15(12)22)29-19(25)10-5-8-13(26-2)17(28-4)16(10)27-3/h5-9H,1-4H3,(H,23,24)/t9-/m1/s1 |
| InChIKey | PNOLUWHXJKWQQI-SECBINFHSA-N |
| XLogP | 3.31 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|