C10H15NO8S2 — CID 88758775
2-(4-amino-3,5-dimethoxyphenyl)sulfonylethyl hydrogen sulfate (PubChem CID 88758775) has the molecular formula C10H15NO8S2 and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-(4-amino-3,5-dimethoxyphenyl)sulfonylethyl hydrogen sulfate.
| Compound Name | 2-(4-amino-3,5-dimethoxyphenyl)sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 88758775 |
| Molecular Formula | C10H15NO8S2 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-(4-amino-3,5-dimethoxyphenyl)sulfonylethyl hydrogen sulfate |
| SMILES | COc1cc(S(=O)(=O)CCOS(=O)(=O)O)cc(OC)c1N |
| InChI | InChI=1S/C10H15NO8S2/c1-17-8-5-7(6-9(18-2)10(8)11)20(12,13)4-3-19-21(14,15)16/h5-6H,3-4,11H2,1-2H3,(H,14,15,16) |
| InChIKey | PXLNVKKADSMYNY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|