C12H13NO9S3 — CID 14670624
7-amino-3-(2-sulfooxyethylsulfonyl)naphthalene-1-sulfonic acid (PubChem CID 14670624) has the molecular formula C12H13NO9S3 and a molecular weight of 411.44 g/mol. Its IUPAC name is 7-amino-3-(2-sulfooxyethylsulfonyl)naphthalene-1-sulfonic acid.
| Compound Name | 7-amino-3-(2-sulfooxyethylsulfonyl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 14670624 |
| Molecular Formula | C12H13NO9S3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 7-amino-3-(2-sulfooxyethylsulfonyl)naphthalene-1-sulfonic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)CCOS(=O)(=O)O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C12H13NO9S3/c13-9-2-1-8-5-10(7-12(11(8)6-9)24(16,17)18)23(14,15)4-3-22-25(19,20)21/h1-2,5-7H,3-4,13H2,(H,16,17,18)(H,19,20,21) |
| InChIKey | DWMQTTUISPICHB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|