C12H13NO6S2 — CID 19914129
6-amino-4-(2-hydroxyethylsulfonyl)naphthalene-2-sulfonic acid (PubChem CID 19914129) has the molecular formula C12H13NO6S2 and a molecular weight of 331.37 g/mol. Its IUPAC name is 6-amino-4-(2-hydroxyethylsulfonyl)naphthalene-2-sulfonic acid.
| Compound Name | 6-amino-4-(2-hydroxyethylsulfonyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 19914129 |
| Molecular Formula | C12H13NO6S2 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 6-amino-4-(2-hydroxyethylsulfonyl)naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)cc(S(=O)(=O)CCO)c2c1 |
| InChI | InChI=1S/C12H13NO6S2/c13-9-2-1-8-5-10(21(17,18)19)7-12(11(8)6-9)20(15,16)4-3-14/h1-2,5-7,14H,3-4,13H2,(H,17,18,19) |
| InChIKey | SKYRHROLNDJNHX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|