C20H22N2O11S4 — CID 19868161
7-[4-amino-2-(2-sulfoethylsulfonyl)anilino]-3-(2-hydroxyethylsulfonyl)naphthalene-1-sulfonic acid (PubChem CID 19868161) has the molecular formula C20H22N2O11S4 and a molecular weight of 594.67 g/mol. Its IUPAC name is 7-[4-amino-2-(2-sulfoethylsulfonyl)anilino]-3-(2-hydroxyethylsulfonyl)naphthalene-1-sulfonic acid.
| Compound Name | 7-[4-amino-2-(2-sulfoethylsulfonyl)anilino]-3-(2-hydroxyethylsulfonyl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 19868161 |
| Molecular Formula | C20H22N2O11S4 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.01 |
| IUPAC Name | 7-[4-amino-2-(2-sulfoethylsulfonyl)anilino]-3-(2-hydroxyethylsulfonyl)naphthalene-1-sulfonic acid |
| SMILES | Nc1ccc(Nc2ccc3cc(S(=O)(=O)CCO)cc(S(=O)(=O)O)c3c2)c(S(=O)(=O)CCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H22N2O11S4/c21-14-2-4-18(20(10-14)35(26,27)7-8-36(28,29)30)22-15-3-1-13-9-16(34(24,25)6-5-23)12-19(17(13)11-15)37(31,32)33/h1-4,9-12,22-23H,5-8,21H2,(H,28,29,30)(H,31,32,33) |
| InChIKey | RLHHMZVKTZLDNM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 235.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|