C18H17NO8S2 — CID 142136529
4-hydroxy-6-[2-hydroxy-5-(2-hydroxyethylsulfonyl)anilino]naphthalene-2-sulfonic acid (PubChem CID 142136529) has the molecular formula C18H17NO8S2 and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-hydroxy-6-[2-hydroxy-5-(2-hydroxyethylsulfonyl)anilino]naphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-6-[2-hydroxy-5-(2-hydroxyethylsulfonyl)anilino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 142136529 |
| Molecular Formula | C18H17NO8S2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 4-hydroxy-6-[2-hydroxy-5-(2-hydroxyethylsulfonyl)anilino]naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2cc(Nc3cc(S(=O)(=O)CCO)ccc3O)ccc2c1 |
| InChI | InChI=1S/C18H17NO8S2/c20-5-6-28(23,24)13-3-4-17(21)16(9-13)19-12-2-1-11-7-14(29(25,26)27)10-18(22)15(11)8-12/h1-4,7-10,19-22H,5-6H2,(H,25,26,27) |
| InChIKey | PFJHESPGIWAPGN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|