C18H17NO11S3 — CID 23532447
2-[4-hydroxy-3-[[8-hydroxy-6-(trioxidanylsulfanyl)naphthalen-2-yl]amino]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 23532447) has the molecular formula C18H17NO11S3 and a molecular weight of 519.53 g/mol. Its IUPAC name is 2-[4-hydroxy-3-[[8-hydroxy-6-(trioxidanylsulfanyl)naphthalen-2-yl]amino]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-hydroxy-3-[[8-hydroxy-6-(trioxidanylsulfanyl)naphthalen-2-yl]amino]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 23532447 |
| Molecular Formula | C18H17NO11S3 |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | 2-[4-hydroxy-3-[[8-hydroxy-6-(trioxidanylsulfanyl)naphthalen-2-yl]amino]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCCS(=O)(=O)c1ccc(O)c(Nc2ccc3cc(SOOO)cc(O)c3c2)c1 |
| InChI | InChI=1S/C18H17NO11S3/c20-17-4-3-14(32(23,24)6-5-28-33(25,26)27)10-16(17)19-12-2-1-11-7-13(31-30-29-22)9-18(21)15(11)8-12/h1-4,7-10,19-22H,5-6H2,(H,25,26,27) |
| InChIKey | XHUCTPIXYHLMIK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 188.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|