C18H17N3O13S4 — CID 135984618
4-amino-5-hydroxy-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135984618) has the molecular formula C18H17N3O13S4 and a molecular weight of 611.61 g/mol. Its IUPAC name is 4-amino-5-hydroxy-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 4-amino-5-hydroxy-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135984618 |
| Molecular Formula | C18H17N3O13S4 |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 610.96 |
| IUPAC Name | 4-amino-5-hydroxy-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)c(S(=O)(=O)O)cc2cc(SOOO)cc(O)c12 |
| InChI | InChI=1S/C18H17N3O13S4/c19-17-16-10(7-12(9-14(16)22)35-34-33-23)8-15(37(26,27)28)18(17)21-20-11-1-3-13(4-2-11)36(24,25)6-5-32-38(29,30)31/h1-4,7-9,22-23H,5-6,19H2,(H,26,27,28)(H,29,30,31)/b21-20+ |
| InChIKey | JVYCNPHHUVFDNW-QZQOTICOSA-N |
| XLogP | 2.81 |
| TPSA | 261.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|