C22H24N6O15S5 — CID 21028671
2,4-diamino-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-5-[[4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 21028671) has the molecular formula C22H24N6O15S5 and a molecular weight of 772.80 g/mol. Its IUPAC name is 2,4-diamino-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-5-[[4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2,4-diamino-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-5-[[4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 21028671 |
| Molecular Formula | C22H24N6O15S5 |
| Molecular Weight | 772.80 g/mol |
| Exact Mass | 771.99 |
| IUPAC Name | 2,4-diamino-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-5-[[4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(S(=O)(=O)CCOSOOO)cc2)cc(S(=O)(=O)O)c(N)c1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H24N6O15S5/c23-20-18(27-25-14-1-5-16(6-2-14)45(30,31)11-9-40-44-43-42-29)13-19(47(34,35)36)21(24)22(20)28-26-15-3-7-17(8-4-15)46(32,33)12-10-41-48(37,38)39/h1-8,13,29H,9-12,23-24H2,(H,34,35,36)(H,37,38,39)/b27-25+,28-26+ |
| InChIKey | VBJKPSRVDMTFET-NBHCHVEOSA-N |
| XLogP | 3.30 |
| TPSA | 335.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|