C31H28N8O15S5 — CID 157242167
5-[[2,6-diamino-3-[(4-methylphenyl)diazenyl]-5-sulfophenyl]diazenyl]-8-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 157242167) has the molecular formula C31H28N8O15S5 and a molecular weight of 912.94 g/mol. Its IUPAC name is 5-[[2,6-diamino-3-[(4-methylphenyl)diazenyl]-5-sulfophenyl]diazenyl]-8-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-[[2,6-diamino-3-[(4-methylphenyl)diazenyl]-5-sulfophenyl]diazenyl]-8-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 157242167 |
| Molecular Formula | C31H28N8O15S5 |
| Molecular Weight | 912.94 g/mol |
| Exact Mass | 912.03 |
| IUPAC Name | 5-[[2,6-diamino-3-[(4-methylphenyl)diazenyl]-5-sulfophenyl]diazenyl]-8-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2cc(S(=O)(=O)O)c(N)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)CCOS(=O)(=O)O)cc4S(=O)(=O)O)c4cc(S(=O)(=O)O)ccc34)c2N)cc1 |
| InChI | InChI=1S/C31H28N8O15S5/c1-17-2-4-18(5-3-17)34-38-26-16-28(58(48,49)50)30(33)31(29(26)32)39-36-23-10-11-24(22-14-20(56(42,43)44)6-8-21(22)23)35-37-25-9-7-19(15-27(25)57(45,46)47)55(40,41)13-12-54-59(51,52)53/h2-11,14-16H,12-13,32-33H2,1H3,(H,42,43,44)(H,45,46,47)(H,48,49,50)(H,51,52,53)/b37-35+,38-34+,39-36+ |
| InChIKey | BVNKYICTICJSMU-WXLCTVOUSA-N |
| XLogP | 5.89 |
| TPSA | 387.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.94 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|