C32H26N6O13S3 — CID 154602860
3,5-dihydroxy-2-[(4-methylphenyl)diazenyl]-4-[[7-sulfo-4-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalen-1-yl]diazenyl]benzoic acid (PubChem CID 154602860) has the molecular formula C32H26N6O13S3 and a molecular weight of 798.79 g/mol. Its IUPAC name is 3,5-dihydroxy-2-[(4-methylphenyl)diazenyl]-4-[[7-sulfo-4-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalen-1-yl]diazenyl]benzoic acid.
| Compound Name | 3,5-dihydroxy-2-[(4-methylphenyl)diazenyl]-4-[[7-sulfo-4-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalen-1-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 154602860 |
| Molecular Formula | C32H26N6O13S3 |
| Molecular Weight | 798.79 g/mol |
| Exact Mass | 798.07 |
| IUPAC Name | 3,5-dihydroxy-2-[(4-methylphenyl)diazenyl]-4-[[7-sulfo-4-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalen-1-yl]diazenyl]benzoic acid |
| SMILES | Cc1ccc(/N=N/c2c(C(=O)O)cc(O)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)CCOS(=O)(=O)O)cc4)c4ccc(S(=O)(=O)O)cc34)c2O)cc1 |
| InChI | InChI=1S/C32H26N6O13S3/c1-18-2-4-19(5-3-18)34-37-29-25(32(41)42)17-28(39)30(31(29)40)38-36-27-13-12-26(23-11-10-22(16-24(23)27)53(45,46)47)35-33-20-6-8-21(9-7-20)52(43,44)15-14-51-54(48,49)50/h2-13,16-17,39-40H,14-15H2,1H3,(H,41,42)(H,45,46,47)(H,48,49,50)/b35-33+,37-34+,38-36+ |
| InChIKey | XLJCRDHFTLXISS-VNMKFWJHSA-N |
| XLogP | 7.34 |
| TPSA | 304.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.79 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|