C32H26N6O11S2 — CID 154602873
3,5-dihydroxy-2-[[6-hydroxy-4-[(4-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-4-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzoic acid (PubChem CID 154602873) has the molecular formula C32H26N6O11S2 and a molecular weight of 734.73 g/mol. Its IUPAC name is 3,5-dihydroxy-2-[[6-hydroxy-4-[(4-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-4-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzoic acid.
| Compound Name | 3,5-dihydroxy-2-[[6-hydroxy-4-[(4-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-4-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 154602873 |
| Molecular Formula | C32H26N6O11S2 |
| Molecular Weight | 734.73 g/mol |
| Exact Mass | 734.11 |
| IUPAC Name | 3,5-dihydroxy-2-[[6-hydroxy-4-[(4-methylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-4-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzoic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3c(C(=O)O)cc(O)c(/N=N/c4ccc(S(=O)(=O)CCOS(=O)(=O)O)cc4)c3O)c3ccc(O)cc23)cc1 |
| InChI | InChI=1S/C32H26N6O11S2/c1-18-2-4-19(5-3-18)33-35-27-13-12-26(23-11-8-21(39)16-24(23)27)36-37-29-25(32(42)43)17-28(40)30(31(29)41)38-34-20-6-9-22(10-7-20)50(44,45)15-14-49-51(46,47)48/h2-13,16-17,39-41H,14-15H2,1H3,(H,42,43)(H,46,47,48)/b35-33+,37-36+,38-34+ |
| InChIKey | PGVAHXZWGCXYHR-VVWJMJBKSA-N |
| XLogP | 7.80 |
| TPSA | 269.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.73 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|