C29H24N8O10S2 — CID 154602872
4-[[3-(carbamoylamino)-4-[(4-ethenylsulfonyl-2-sulfophenyl)diazenyl]phenyl]diazenyl]-3,5-dihydroxy-2-[(4-methylphenyl)diazenyl]benzoic acid (PubChem CID 154602872) has the molecular formula C29H24N8O10S2 and a molecular weight of 708.69 g/mol. Its IUPAC name is 4-[[3-(carbamoylamino)-4-[(4-ethenylsulfonyl-2-sulfophenyl)diazenyl]phenyl]diazenyl]-3,5-dihydroxy-2-[(4-methylphenyl)diazenyl]benzoic acid.
| Compound Name | 4-[[3-(carbamoylamino)-4-[(4-ethenylsulfonyl-2-sulfophenyl)diazenyl]phenyl]diazenyl]-3,5-dihydroxy-2-[(4-methylphenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 154602872 |
| Molecular Formula | C29H24N8O10S2 |
| Molecular Weight | 708.69 g/mol |
| Exact Mass | 708.11 |
| IUPAC Name | 4-[[3-(carbamoylamino)-4-[(4-ethenylsulfonyl-2-sulfophenyl)diazenyl]phenyl]diazenyl]-3,5-dihydroxy-2-[(4-methylphenyl)diazenyl]benzoic acid |
| SMILES | C=CS(=O)(=O)c1ccc(/N=N/c2ccc(/N=N/c3c(O)cc(C(=O)O)c(/N=N/c4ccc(C)cc4)c3O)cc2NC(N)=O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C29H24N8O10S2/c1-3-48(43,44)18-9-11-21(24(13-18)49(45,46)47)35-34-20-10-8-17(12-22(20)31-29(30)42)33-37-26-23(38)14-19(28(40)41)25(27(26)39)36-32-16-6-4-15(2)5-7-16/h3-14,38-39H,1H2,2H3,(H,40,41)(H3,30,31,42)(H,45,46,47)/b35-34+,36-32+,37-33+ |
| InChIKey | FRHHWIDEFJJARH-PFXQPZMOSA-N |
| XLogP | 7.01 |
| TPSA | 295.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|