C31H29N7O17S4 — CID 155009121
4-[[3-acetamido-4-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-3,5-dihydroxy-2-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzoic acid (PubChem CID 155009121) has the molecular formula C31H29N7O17S4 and a molecular weight of 899.87 g/mol. Its IUPAC name is 4-[[3-acetamido-4-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-3,5-dihydroxy-2-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[3-acetamido-4-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-3,5-dihydroxy-2-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 155009121 |
| Molecular Formula | C31H29N7O17S4 |
| Molecular Weight | 899.87 g/mol |
| Exact Mass | 899.05 |
| IUPAC Name | 4-[[3-acetamido-4-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-3,5-dihydroxy-2-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzoic acid |
| SMILES | CC(=O)Nc1cc(/N=N/c2c(O)cc(C(=O)O)c(/N=N/c3ccc(S(=O)(=O)CCOS(=O)(=O)O)cc3)c2O)ccc1/N=N/c1cccc(S(=O)(=O)CCOS(=O)(=O)O)c1 |
| InChI | InChI=1S/C31H29N7O17S4/c1-18(39)32-26-16-21(7-10-25(26)36-34-20-3-2-4-23(15-20)57(46,47)14-12-55-59(51,52)53)35-38-29-27(40)17-24(31(42)43)28(30(29)41)37-33-19-5-8-22(9-6-19)56(44,45)13-11-54-58(48,49)50/h2-10,15-17,40-41H,11-14H2,1H3,(H,32,39)(H,42,43)(H,48,49,50)(H,51,52,53)/b36-34+,37-33+,38-35+ |
| InChIKey | NEXJSCNDJCLCJC-OBGXUDLZSA-N |
| XLogP | 5.19 |
| TPSA | 376.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|