C20H19N3O9S2 — CID 3022856
2-[3-[(8-acetamido-2-hydroxynaphthalen-1-yl)diazenyl]-4-hydroxyphenyl]sulfonylethyl hydrogen sulfate (PubChem CID 3022856) has the molecular formula C20H19N3O9S2 and a molecular weight of 509.52 g/mol. Its IUPAC name is 2-[3-[(8-acetamido-2-hydroxynaphthalen-1-yl)diazenyl]-4-hydroxyphenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[3-[(8-acetamido-2-hydroxynaphthalen-1-yl)diazenyl]-4-hydroxyphenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 3022856 |
| Molecular Formula | C20H19N3O9S2 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 2-[3-[(8-acetamido-2-hydroxynaphthalen-1-yl)diazenyl]-4-hydroxyphenyl]sulfonylethyl hydrogen sulfate |
| SMILES | CC(=O)Nc1cccc2ccc(O)c(/N=N/c3cc(S(=O)(=O)CCOS(=O)(=O)O)ccc3O)c12 |
| InChI | InChI=1S/C20H19N3O9S2/c1-12(24)21-15-4-2-3-13-5-7-18(26)20(19(13)15)23-22-16-11-14(6-8-17(16)25)33(27,28)10-9-32-34(29,30)31/h2-8,11,25-26H,9-10H2,1H3,(H,21,24)(H,29,30,31)/b23-22+ |
| InChIKey | NCJCKBIBRFVUKV-GHVJWSGMSA-N |
| XLogP | 3.22 |
| TPSA | 192.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|