C21H21CuN3O15S4 — CID 160789368
copper;4-hydroxy-3-[[2-hydroxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(3-sulfopropanoylamino)naphthalene-2-sulfonic acid (PubChem CID 160789368) has the molecular formula C21H21CuN3O15S4 and a molecular weight of 747.22 g/mol. Its IUPAC name is copper;4-hydroxy-3-[[2-hydroxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(3-sulfopropanoylamino)naphthalene-2-sulfonic acid.
| Compound Name | copper;4-hydroxy-3-[[2-hydroxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(3-sulfopropanoylamino)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 160789368 |
| Molecular Formula | C21H21CuN3O15S4 |
| Molecular Weight | 747.22 g/mol |
| Exact Mass | 745.92 |
| IUPAC Name | copper;4-hydroxy-3-[[2-hydroxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(3-sulfopropanoylamino)naphthalene-2-sulfonic acid |
| SMILES | O=C(CCS(=O)(=O)O)Nc1ccc2c(O)c(/N=N/c3cc(S(=O)(=O)CCOS(=O)(=O)O)ccc3O)c(S(=O)(=O)O)cc2c1.[Cu] |
| InChI | InChI=1S/C21H21N3O15S4.Cu/c25-17-4-2-14(40(28,29)8-6-39-43(36,37)38)11-16(17)23-24-20-18(42(33,34)35)10-12-9-13(1-3-15(12)21(20)27)22-19(26)5-7-41(30,31)32;/h1-4,9-11,25,27H,5-8H2,(H,22,26)(H,30,31,32)(H,33,34,35)(H,36,37,38);/b24-23+; |
| InChIKey | SBQDHHZCRUINJN-XMXXDQCKSA-N |
| XLogP | 1.72 |
| TPSA | 300.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|