C23H27ClN4O7S2 — CID 161016541
3-[[5-[[2-(2-chloroethylsulfonyl)acetyl]amino]-2-methylphenyl]diazenyl]-4-hydroxy-7-(methylamino)naphthalene-2-sulfonic acid;methane (PubChem CID 161016541) has the molecular formula C23H27ClN4O7S2 and a molecular weight of 571.08 g/mol. Its IUPAC name is 3-[[5-[[2-(2-chloroethylsulfonyl)acetyl]amino]-2-methylphenyl]diazenyl]-4-hydroxy-7-(methylamino)naphthalene-2-sulfonic acid;methane.
| Compound Name | 3-[[5-[[2-(2-chloroethylsulfonyl)acetyl]amino]-2-methylphenyl]diazenyl]-4-hydroxy-7-(methylamino)naphthalene-2-sulfonic acid;methane |
|---|---|
| PubChem CID | 161016541 |
| Molecular Formula | C23H27ClN4O7S2 |
| Molecular Weight | 571.08 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 3-[[5-[[2-(2-chloroethylsulfonyl)acetyl]amino]-2-methylphenyl]diazenyl]-4-hydroxy-7-(methylamino)naphthalene-2-sulfonic acid;methane |
| SMILES | C.CNc1ccc2c(O)c(/N=N/c3cc(NC(=O)CS(=O)(=O)CCCl)ccc3C)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C22H23ClN4O7S2.CH4/c1-13-3-4-16(25-20(28)12-35(30,31)8-7-23)11-18(13)26-27-21-19(36(32,33)34)10-14-9-15(24-2)5-6-17(14)22(21)29;/h3-6,9-11,24,29H,7-8,12H2,1-2H3,(H,25,28)(H,32,33,34);1H4/b27-26+; |
| InChIKey | TXUKPHUGRKQDRZ-JGUILPGDSA-N |
| XLogP | 4.79 |
| TPSA | 174.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|