C24H24N4O4S — CID 145189884
3-[(4-amino-2,5-dimethylphenyl)diazenyl]-7-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 145189884) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 3-[(4-amino-2,5-dimethylphenyl)diazenyl]-7-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 3-[(4-amino-2,5-dimethylphenyl)diazenyl]-7-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 145189884 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 3-[(4-amino-2,5-dimethylphenyl)diazenyl]-7-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | C=C/C=C\C(=C)Nc1ccc2c(O)c(/N=N/c3cc(C)c(N)cc3C)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C24H24N4O4S/c1-5-6-7-16(4)26-18-8-9-19-17(12-18)13-22(33(30,31)32)23(24(19)29)28-27-21-11-14(2)20(25)10-15(21)3/h5-13,26,29H,1,4,25H2,2-3H3,(H,30,31,32)/b7-6-,28-27+ |
| InChIKey | YJDJAPWTCZUMMW-GSVSZWNMSA-N |
| XLogP | 6.07 |
| TPSA | 137.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|