C18H16N2O13S4 — CID 165340812
4-[[2-hydroxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 165340812) has the molecular formula C18H16N2O13S4 and a molecular weight of 596.60 g/mol. Its IUPAC name is 4-[[2-hydroxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[2-hydroxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 165340812 |
| Molecular Formula | C18H16N2O13S4 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 595.95 |
| IUPAC Name | 4-[[2-hydroxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)OCCS(=O)(=O)c1ccc(O)c(/N=N/c2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc23)c1 |
| InChI | InChI=1S/C18H16N2O13S4/c21-18-4-2-12(34(22,23)6-5-33-37(30,31)32)9-17(18)20-19-16-10-14(36(27,28)29)8-11-7-13(35(24,25)26)1-3-15(11)16/h1-4,7-10,21H,5-6H2,(H,24,25,26)(H,27,28,29)(H,30,31,32)/b20-19+ |
| InChIKey | MMULRACGDGLUTJ-FMQUCBEESA-N |
| XLogP | 2.05 |
| TPSA | 251.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|