C19H19N3O16S5 — CID 136613901
4-hydroxy-7-(sulfomethylamino)-8-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136613901) has the molecular formula C19H19N3O16S5 and a molecular weight of 705.70 g/mol. Its IUPAC name is 4-hydroxy-7-(sulfomethylamino)-8-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-7-(sulfomethylamino)-8-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136613901 |
| Molecular Formula | C19H19N3O16S5 |
| Molecular Weight | 705.70 g/mol |
| Exact Mass | 704.94 |
| IUPAC Name | 4-hydroxy-7-(sulfomethylamino)-8-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)CNc1ccc2c(O)cc(S(=O)(=O)O)cc2c1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C19H19N3O16S5/c23-17-8-12(41(29,30)31)7-14-13(17)2-4-16(20-10-40(26,27)28)19(14)22-21-15-3-1-11(9-18(15)42(32,33)34)39(24,25)6-5-38-43(35,36)37/h1-4,7-9,20,23H,5-6,10H2,(H,26,27,28)(H,29,30,31)(H,32,33,34)(H,35,36,37)/b22-21+ |
| InChIKey | MUCLGEIOHVLUFD-QURGRASLSA-N |
| XLogP | 1.30 |
| TPSA | 317.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.70 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|