C22H24N6O18S6 — CID 89366361
2-[[2,4-diamino-5-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid (PubChem CID 89366361) has the molecular formula C22H24N6O18S6 and a molecular weight of 852.86 g/mol. Its IUPAC name is 2-[[2,4-diamino-5-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid.
| Compound Name | 2-[[2,4-diamino-5-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89366361 |
| Molecular Formula | C22H24N6O18S6 |
| Molecular Weight | 852.86 g/mol |
| Exact Mass | 851.95 |
| IUPAC Name | 2-[[2,4-diamino-5-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
| SMILES | Nc1cc(N)c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2S(=O)(=O)O)cc1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C22H24N6O18S6/c23-15-11-16(24)20(28-26-18-4-2-14(10-22(18)50(36,37)38)48(31,32)8-6-46-52(42,43)44)12-19(15)27-25-17-3-1-13(9-21(17)49(33,34)35)47(29,30)7-5-45-51(39,40)41/h1-4,9-12H,5-8,23-24H2,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,42,43,44)/b27-25+,28-26+ |
| InChIKey | DRJZCVXXNGSUJP-NBHCHVEOSA-N |
| XLogP | 1.36 |
| TPSA | 405.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.86 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|