C23H26N6O16S5 — CID 59858395
2-[[2,4-diamino-5-[[2-methoxy-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]phenyl]diazenyl]-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]benzenesulfonic acid (PubChem CID 59858395) has the molecular formula C23H26N6O16S5 and a molecular weight of 802.82 g/mol. Its IUPAC name is 2-[[2,4-diamino-5-[[2-methoxy-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]phenyl]diazenyl]-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]benzenesulfonic acid.
| Compound Name | 2-[[2,4-diamino-5-[[2-methoxy-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]phenyl]diazenyl]-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59858395 |
| Molecular Formula | C23H26N6O16S5 |
| Molecular Weight | 802.82 g/mol |
| Exact Mass | 802.00 |
| IUPAC Name | 2-[[2,4-diamino-5-[[2-methoxy-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]phenyl]diazenyl]-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]benzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)CCOSOOO)cc1/N=N/c1cc(/N=N/c2ccc(S(=O)(=O)CCOSOOO)cc2S(=O)(=O)O)c(N)cc1N |
| InChI | InChI=1S/C23H26N6O16S5/c1-39-22-5-3-14(48(32,33)8-6-40-46-44-42-30)10-21(22)29-28-20-13-19(16(24)12-17(20)25)27-26-18-4-2-15(11-23(18)50(36,37)38)49(34,35)9-7-41-47-45-43-31/h2-5,10-13,30-31H,6-9,24-25H2,1H3,(H,36,37,38)/b27-26+,29-28+ |
| InChIKey | LEXTUMBYMBHMLT-ZDXBJJIESA-N |
| XLogP | 4.49 |
| TPSA | 329.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.82 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|