C15H16N4Na2O10S3 — CID 59836876
disodium;2,4-diamino-5-[[2-methoxy-5-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate (PubChem CID 59836876) has the molecular formula C15H16N4Na2O10S3 and a molecular weight of 554.49 g/mol. Its IUPAC name is disodium;2,4-diamino-5-[[2-methoxy-5-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate.
| Compound Name | disodium;2,4-diamino-5-[[2-methoxy-5-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 59836876 |
| Molecular Formula | C15H16N4Na2O10S3 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 553.98 |
| IUPAC Name | disodium;2,4-diamino-5-[[2-methoxy-5-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)CCOSOO[O-])cc1/N=N/c1cc(S(=O)(=O)[O-])c(N)cc1N.[Na+].[Na+] |
| InChI | InChI=1S/C15H18N4O10S3.2Na/c1-26-14-3-2-9(31(21,22)5-4-27-30-29-28-20)6-13(14)19-18-12-8-15(32(23,24)25)11(17)7-10(12)16;;/h2-3,6-8,20H,4-5,16-17H2,1H3,(H,23,24,25);;/q;2*+1/p-2/b19-18+;; |
| InChIKey | KOXFPWCVMFJRMJ-BUFQOAPZSA-L |
| XLogP | -5.24 |
| TPSA | 228.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | -5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|