C17H13Cl2N7Na2O9S3 — CID 59836755
disodium;2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-[[4-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate (PubChem CID 59836755) has the molecular formula C17H13Cl2N7Na2O9S3 and a molecular weight of 672.42 g/mol. Its IUPAC name is disodium;2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-[[4-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate.
| Compound Name | disodium;2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-[[4-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 59836755 |
| Molecular Formula | C17H13Cl2N7Na2O9S3 |
| Molecular Weight | 672.42 g/mol |
| Exact Mass | 670.91 |
| IUPAC Name | disodium;2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-[[4-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate |
| SMILES | Nc1cc(Nc2nc(Cl)nc(Cl)n2)c(/N=N/c2ccc(S(=O)(=O)CCOSOO[O-])cc2)cc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C17H15Cl2N7O9S3.2Na/c18-15-22-16(19)24-17(23-15)21-12-7-11(20)14(38(30,31)32)8-13(12)26-25-9-1-3-10(4-2-9)37(28,29)6-5-33-36-35-34-27;;/h1-4,7-8,27H,5-6,20H2,(H,30,31,32)(H,21,22,23,24);;/q;2*+1/p-2/b26-25+;; |
| InChIKey | QKQPSPDIGUAUGI-LHPVOXLHSA-L |
| XLogP | -3.59 |
| TPSA | 243.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.42 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|