C25H24ClN8O4S+ — CID 21361221
1-[4-[5-amino-4-methyl-2-[(4-propylsulfonylphenyl)diazenyl]anilino]-6-chloro-1,3,5-triazin-2-yl]pyridin-1-ium-3-carboxylic acid (PubChem CID 21361221) has the molecular formula C25H24ClN8O4S+ and a molecular weight of 568.04 g/mol. Its IUPAC name is 1-[4-[5-amino-4-methyl-2-[(4-propylsulfonylphenyl)diazenyl]anilino]-6-chloro-1,3,5-triazin-2-yl]pyridin-1-ium-3-carboxylic acid.
| Compound Name | 1-[4-[5-amino-4-methyl-2-[(4-propylsulfonylphenyl)diazenyl]anilino]-6-chloro-1,3,5-triazin-2-yl]pyridin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 21361221 |
| Molecular Formula | C25H24ClN8O4S+ |
| Molecular Weight | 568.04 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 1-[4-[5-amino-4-methyl-2-[(4-propylsulfonylphenyl)diazenyl]anilino]-6-chloro-1,3,5-triazin-2-yl]pyridin-1-ium-3-carboxylic acid |
| SMILES | CCCS(=O)(=O)c1ccc(/N=N/c2cc(C)c(N)cc2Nc2nc(Cl)nc(-[n+]3cccc(C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C25H23ClN8O4S/c1-3-11-39(37,38)18-8-6-17(7-9-18)32-33-21-12-15(2)19(27)13-20(21)28-24-29-23(26)30-25(31-24)34-10-4-5-16(14-34)22(35)36/h4-10,12-14H,3,11H2,1-2H3,(H3-,27,28,29,30,31,32,35,36)/p+1 |
| InChIKey | GDLJLPDOWJXKCU-UHFFFAOYSA-O |
| XLogP | 4.73 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.04 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|