C18H18ClN7O9S3 — CID 89159828
4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methyl-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 89159828) has the molecular formula C18H18ClN7O9S3 and a molecular weight of 608.04 g/mol. Its IUPAC name is 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methyl-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methyl-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89159828 |
| Molecular Formula | C18H18ClN7O9S3 |
| Molecular Weight | 608.04 g/mol |
| Exact Mass | 607.00 |
| IUPAC Name | 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methyl-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc(Nc2nc(N)nc(Cl)n2)c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C18H18ClN7O9S3/c1-10-8-13(21-18-23-16(19)22-17(20)24-18)14(9-15(10)37(29,30)31)26-25-11-2-4-12(5-3-11)36(27,28)7-6-35-38(32,33)34/h2-5,8-9H,6-7H2,1H3,(H,29,30,31)(H,32,33,34)(H3,20,21,22,23,24)/b26-25+ |
| InChIKey | SWRIJPKGHYANKA-OCEACIFDSA-N |
| XLogP | 2.41 |
| TPSA | 253.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.04 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|