C15H16N2O9S3 — CID 89159905
2-methyl-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 89159905) has the molecular formula C15H16N2O9S3 and a molecular weight of 464.50 g/mol. Its IUPAC name is 2-methyl-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-methyl-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89159905 |
| Molecular Formula | C15H16N2O9S3 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | 2-methyl-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C15H16N2O9S3/c1-11-2-3-13(10-15(11)28(20,21)22)17-16-12-4-6-14(7-5-12)27(18,19)9-8-26-29(23,24)25/h2-7,10H,8-9H2,1H3,(H,20,21,22)(H,23,24,25)/b17-16+ |
| InChIKey | RUCFWKUOKXNFEJ-WUKNDPDISA-N |
| XLogP | 2.25 |
| TPSA | 176.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|