C13H12N4O6S3 — CID 143390710
2-[4-[(5-amino-4-cyanothiophen-2-yl)diazenyl]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 143390710) has the molecular formula C13H12N4O6S3 and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-[4-[(5-amino-4-cyanothiophen-2-yl)diazenyl]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[(5-amino-4-cyanothiophen-2-yl)diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 143390710 |
| Molecular Formula | C13H12N4O6S3 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 2-[4-[(5-amino-4-cyanothiophen-2-yl)diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | N#Cc1cc(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)sc1N |
| InChI | InChI=1S/C13H12N4O6S3/c14-8-9-7-12(24-13(9)15)17-16-10-1-3-11(4-2-10)25(18,19)6-5-23-26(20,21)22/h1-4,7H,5-6,15H2,(H,20,21,22)/b17-16+ |
| InChIKey | JVXSDUSQXKXWEU-WUKNDPDISA-N |
| XLogP | 2.21 |
| TPSA | 172.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|