C29H29N7O16S5 — CID 21028687
2,4-diamino-5-[[3-[[4-(2-sulfooxyethylsulfonyl)phenyl]carbamoyl]phenyl]diazenyl]-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 21028687) has the molecular formula C29H29N7O16S5 and a molecular weight of 891.92 g/mol. Its IUPAC name is 2,4-diamino-5-[[3-[[4-(2-sulfooxyethylsulfonyl)phenyl]carbamoyl]phenyl]diazenyl]-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2,4-diamino-5-[[3-[[4-(2-sulfooxyethylsulfonyl)phenyl]carbamoyl]phenyl]diazenyl]-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 21028687 |
| Molecular Formula | C29H29N7O16S5 |
| Molecular Weight | 891.92 g/mol |
| Exact Mass | 891.03 |
| IUPAC Name | 2,4-diamino-5-[[3-[[4-(2-sulfooxyethylsulfonyl)phenyl]carbamoyl]phenyl]diazenyl]-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Nc1c(/N=N/c2cccc(C(=O)Nc3ccc(S(=O)(=O)CCOS(=O)(=O)O)cc3)c2)cc(S(=O)(=O)O)c(N)c1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C29H29N7O16S5/c30-26-24(17-25(55(42,43)44)27(31)28(26)36-33-20-6-10-23(11-7-20)54(40,41)15-13-52-57(48,49)50)35-34-21-3-1-2-18(16-21)29(37)32-19-4-8-22(9-5-19)53(38,39)14-12-51-56(45,46)47/h1-11,16-17H,12-15,30-31H2,(H,32,37)(H,42,43,44)(H,45,46,47)(H,48,49,50)/b35-34+,36-33+ |
| InChIKey | VPPSRSHEOSHUJR-SJMAOBPSSA-N |
| XLogP | 3.37 |
| TPSA | 380.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.92 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|