C29H28N8O17S5 — CID 155608084
3,5-diamino-2,4-bis[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[(2-sulfophenyl)diazenyl]benzoic acid (PubChem CID 155608084) has the molecular formula C29H28N8O17S5 and a molecular weight of 920.92 g/mol. Its IUPAC name is 3,5-diamino-2,4-bis[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[(2-sulfophenyl)diazenyl]benzoic acid.
| Compound Name | 3,5-diamino-2,4-bis[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[(2-sulfophenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 155608084 |
| Molecular Formula | C29H28N8O17S5 |
| Molecular Weight | 920.92 g/mol |
| Exact Mass | 920.02 |
| IUPAC Name | 3,5-diamino-2,4-bis[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[(2-sulfophenyl)diazenyl]benzoic acid |
| SMILES | Nc1c(/N=N/c2cccc(S(=O)(=O)CCOS(=O)(=O)O)c2)c(N)c(/N=N/c2ccccc2S(=O)(=O)O)c(C(=O)O)c1/N=N/c1cccc(S(=O)(=O)CCOS(=O)(=O)O)c1 |
| InChI | InChI=1S/C29H28N8O17S5/c30-24-26(35-32-17-5-3-7-19(15-17)55(40,41)13-11-53-58(47,48)49)23(29(38)39)27(36-34-21-9-1-2-10-22(21)57(44,45)46)25(31)28(24)37-33-18-6-4-8-20(16-18)56(42,43)14-12-54-59(50,51)52/h1-10,15-16H,11-14,30-31H2,(H,38,39)(H,44,45,46)(H,47,48,49)(H,50,51,52)/b35-32+,36-34+,37-33+ |
| InChIKey | WJVIFPXLBVYQJC-BLMQCLIWSA-N |
| XLogP | 4.23 |
| TPSA | 413.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|