C18H17N3O10S3 — CID 135755784
6-amino-4-hydroxy-5-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135755784) has the molecular formula C18H17N3O10S3 and a molecular weight of 531.55 g/mol. Its IUPAC name is 6-amino-4-hydroxy-5-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-amino-4-hydroxy-5-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135755784 |
| Molecular Formula | C18H17N3O10S3 |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | 6-amino-4-hydroxy-5-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)cc(O)c2c1/N=N/c1cccc(S(=O)(=O)CCOS(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H17N3O10S3/c19-15-5-4-11-8-14(33(25,26)27)10-16(22)17(11)18(15)21-20-12-2-1-3-13(9-12)32(23,24)7-6-31-34(28,29)30/h1-5,8-10,22H,6-7,19H2,(H,25,26,27)(H,28,29,30)/b21-20+ |
| InChIKey | AAWXIIILCYFQHH-QZQOTICOSA-N |
| XLogP | 2.38 |
| TPSA | 223.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|