C20H20N4O8S2 — CID 136917521
5-[[4-[acetyl(ethyl)amino]-3-sulfophenyl]diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136917521) has the molecular formula C20H20N4O8S2 and a molecular weight of 508.53 g/mol. Its IUPAC name is 5-[[4-[acetyl(ethyl)amino]-3-sulfophenyl]diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 5-[[4-[acetyl(ethyl)amino]-3-sulfophenyl]diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136917521 |
| Molecular Formula | C20H20N4O8S2 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 5-[[4-[acetyl(ethyl)amino]-3-sulfophenyl]diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CCN(C(C)=O)c1ccc(/N=N/c2c(N)ccc3cc(S(=O)(=O)O)cc(O)c23)cc1S(=O)(=O)O |
| InChI | InChI=1S/C20H20N4O8S2/c1-3-24(11(2)25)16-7-5-13(9-18(16)34(30,31)32)22-23-20-15(21)6-4-12-8-14(33(27,28)29)10-17(26)19(12)20/h4-10,26H,3,21H2,1-2H3,(H,27,28,29)(H,30,31,32)/b23-22+ |
| InChIKey | VGYFOYQEFSJYGY-GHVJWSGMSA-N |
| XLogP | 3.41 |
| TPSA | 200.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|