C23H20N4O9S3 — CID 3023377
6-amino-4-hydroxy-5-[[4-[(4-methyl-2-sulfophenyl)sulfamoyl]phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 3023377) has the molecular formula C23H20N4O9S3 and a molecular weight of 592.63 g/mol. Its IUPAC name is 6-amino-4-hydroxy-5-[[4-[(4-methyl-2-sulfophenyl)sulfamoyl]phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-amino-4-hydroxy-5-[[4-[(4-methyl-2-sulfophenyl)sulfamoyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 3023377 |
| Molecular Formula | C23H20N4O9S3 |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.04 |
| IUPAC Name | 6-amino-4-hydroxy-5-[[4-[(4-methyl-2-sulfophenyl)sulfamoyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(/N=N/c3c(N)ccc4cc(S(=O)(=O)O)cc(O)c34)cc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C23H20N4O9S3/c1-13-2-9-19(21(10-13)39(34,35)36)27-37(29,30)16-6-4-15(5-7-16)25-26-23-18(24)8-3-14-11-17(38(31,32)33)12-20(28)22(14)23/h2-12,27-28H,24H2,1H3,(H,31,32,33)(H,34,35,36)/b26-25+ |
| InChIKey | VRSOZYANKNDKQO-OCEACIFDSA-N |
| XLogP | 4.15 |
| TPSA | 225.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|