C27H21ClN10O9S3 — CID 136988034
6-amino-5-[[5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-[(4-ethenylsulfonylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136988034) has the molecular formula C27H21ClN10O9S3 and a molecular weight of 761.18 g/mol. Its IUPAC name is 6-amino-5-[[5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-[(4-ethenylsulfonylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-amino-5-[[5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-[(4-ethenylsulfonylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136988034 |
| Molecular Formula | C27H21ClN10O9S3 |
| Molecular Weight | 761.18 g/mol |
| Exact Mass | 760.03 |
| IUPAC Name | 6-amino-5-[[5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-[(4-ethenylsulfonylphenyl)diazenyl]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(/N=N\c2cc(S(=O)(=O)O)c(/N=N/c3c(N)ccc4cc(S(=O)(=O)O)cc(O)c34)cc2Nc2nc(N)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C27H21ClN10O9S3/c1-2-48(40,41)15-6-4-14(5-7-15)35-36-19-12-22(50(45,46)47)20(11-18(19)31-27-33-25(28)32-26(30)34-27)37-38-24-17(29)8-3-13-9-16(49(42,43)44)10-21(39)23(13)24/h2-12,39H,1,29H2,(H,42,43,44)(H,45,46,47)(H3,30,31,32,33,34)/b36-35-,38-37+ |
| InChIKey | GURHLZYUZSOTHV-HSXOZYESSA-N |
| XLogP | 5.53 |
| TPSA | 315.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.18 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|