C28H23ClN8O12S4 — CID 163619244
6-amino-5-[[4-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-4-hydroxy-3-(sulfomethyl)naphthalene-2-sulfonic acid (PubChem CID 163619244) has the molecular formula C28H23ClN8O12S4 and a molecular weight of 827.26 g/mol. Its IUPAC name is 6-amino-5-[[4-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-4-hydroxy-3-(sulfomethyl)naphthalene-2-sulfonic acid.
| Compound Name | 6-amino-5-[[4-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-4-hydroxy-3-(sulfomethyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 163619244 |
| Molecular Formula | C28H23ClN8O12S4 |
| Molecular Weight | 827.26 g/mol |
| Exact Mass | 826.00 |
| IUPAC Name | 6-amino-5-[[4-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-4-hydroxy-3-(sulfomethyl)naphthalene-2-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(Nc2nc(Cl)nc(Nc3ccc(/N=N/c4c(N)ccc5cc(S(=O)(=O)O)c(CS(=O)(=O)O)c(O)c45)c(S(=O)(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C28H23ClN8O12S4/c1-2-50(39,40)17-7-4-15(5-8-17)31-27-33-26(29)34-28(35-27)32-16-6-10-20(22(12-16)53(47,48)49)36-37-24-19(30)9-3-14-11-21(52(44,45)46)18(13-51(41,42)43)25(38)23(14)24/h2-12,38H,1,13,30H2,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H2,31,32,33,34,35)/b37-36+ |
| InChIKey | HMRRDCWOKQQPEB-BSRQYYOTSA-N |
| XLogP | 4.67 |
| TPSA | 330.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|