C32H27ClN8O10S3 — CID 135839766
7-[[4-[4-[(2-amino-8-hydroxy-3,6-dimethylnaphthalen-1-yl)diazenyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]amino]-5-methylnaphthalene-1,3-disulfonic acid (PubChem CID 135839766) has the molecular formula C32H27ClN8O10S3 and a molecular weight of 815.27 g/mol. Its IUPAC name is 7-[[4-[4-[(2-amino-8-hydroxy-3,6-dimethylnaphthalen-1-yl)diazenyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]amino]-5-methylnaphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[4-[4-[(2-amino-8-hydroxy-3,6-dimethylnaphthalen-1-yl)diazenyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]amino]-5-methylnaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 135839766 |
| Molecular Formula | C32H27ClN8O10S3 |
| Molecular Weight | 815.27 g/mol |
| Exact Mass | 814.07 |
| IUPAC Name | 7-[[4-[4-[(2-amino-8-hydroxy-3,6-dimethylnaphthalen-1-yl)diazenyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]amino]-5-methylnaphthalene-1,3-disulfonic acid |
| SMILES | Cc1cc(O)c2c(/N=N/c3ccc(Nc4nc(Cl)nc(Nc5cc(C)c6cc(S(=O)(=O)O)cc(S(=O)(=O)O)c6c5)n4)cc3S(=O)(=O)O)c(N)c(C)cc2c1 |
| InChI | InChI=1S/C32H27ClN8O10S3/c1-14-6-17-8-16(3)28(34)29(27(17)24(42)7-14)41-40-23-5-4-18(11-26(23)54(49,50)51)35-31-37-30(33)38-32(39-31)36-19-9-15(2)21-12-20(52(43,44)45)13-25(22(21)10-19)53(46,47)48/h4-13,42H,34H2,1-3H3,(H,43,44,45)(H,46,47,48)(H,49,50,51)(H2,35,36,37,38,39)/b41-40+ |
| InChIKey | BYUOJYBZZIQPQI-CDJCAARLSA-N |
| XLogP | 6.69 |
| TPSA | 296.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.27 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|