C27H25ClN8O10S3 — CID 20658965
2-[[4-[4-[2-(2-amino-8-hydroxy-3,6-dimethylnaphthalen-1-yl)hydrazinyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid (PubChem CID 20658965) has the molecular formula C27H25ClN8O10S3 and a molecular weight of 753.20 g/mol. Its IUPAC name is 2-[[4-[4-[2-(2-amino-8-hydroxy-3,6-dimethylnaphthalen-1-yl)hydrazinyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-[4-[2-(2-amino-8-hydroxy-3,6-dimethylnaphthalen-1-yl)hydrazinyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 20658965 |
| Molecular Formula | C27H25ClN8O10S3 |
| Molecular Weight | 753.20 g/mol |
| Exact Mass | 752.05 |
| IUPAC Name | 2-[[4-[4-[2-(2-amino-8-hydroxy-3,6-dimethylnaphthalen-1-yl)hydrazinyl]-3-sulfoanilino]-6-chloro-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
| SMILES | Cc1cc(O)c2c(NNc3ccc(Nc4nc(Cl)nc(Nc5cc(S(=O)(=O)O)ccc5S(=O)(=O)O)n4)cc3S(=O)(=O)O)c(N)c(C)cc2c1 |
| InChI | InChI=1S/C27H25ClN8O10S3/c1-12-7-14-9-13(2)23(29)24(22(14)19(37)8-12)36-35-17-5-3-15(10-21(17)49(44,45)46)30-26-32-25(28)33-27(34-26)31-18-11-16(47(38,39)40)4-6-20(18)48(41,42)43/h3-11,35-37H,29H2,1-2H3,(H,38,39,40)(H,41,42,43)(H,44,45,46)(H2,30,31,32,33,34) |
| InChIKey | DBAHJRDDXJVOEK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 296.15 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|