C10H11ClN6O5S2 — CID 89318529
2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-(methylsulfamoyl)benzenesulfonic acid (PubChem CID 89318529) has the molecular formula C10H11ClN6O5S2 and a molecular weight of 394.82 g/mol. Its IUPAC name is 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-(methylsulfamoyl)benzenesulfonic acid.
| Compound Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-(methylsulfamoyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89318529 |
| Molecular Formula | C10H11ClN6O5S2 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-(methylsulfamoyl)benzenesulfonic acid |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)O)c(Nc2nc(N)nc(Cl)n2)c1 |
| InChI | InChI=1S/C10H11ClN6O5S2/c1-13-23(18,19)5-2-3-7(24(20,21)22)6(4-5)14-10-16-8(11)15-9(12)17-10/h2-4,13H,1H3,(H,20,21,22)(H3,12,14,15,16,17) |
| InChIKey | CAZNXUCGTICSNZ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 177.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|