C29H20ClN9O12S4 — CID 11970962
2-[[4-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-7-sulfonaphthalen-1-yl]diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzene-1,4-disulfonic acid (PubChem CID 11970962) has the molecular formula C29H20ClN9O12S4 and a molecular weight of 850.25 g/mol. Its IUPAC name is 2-[[4-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-7-sulfonaphthalen-1-yl]diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-7-sulfonaphthalen-1-yl]diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 11970962 |
| Molecular Formula | C29H20ClN9O12S4 |
| Molecular Weight | 850.25 g/mol |
| Exact Mass | 848.98 |
| IUPAC Name | 2-[[4-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-7-sulfonaphthalen-1-yl]diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]benzene-1,4-disulfonic acid |
| SMILES | Nc1nc(Cl)nc(Nc2ccc(/N=N/c3ccc(/N=N/c4cc(S(=O)(=O)O)ccc4S(=O)(=O)O)c4cc(S(=O)(=O)O)ccc34)c3cc(S(=O)(=O)O)ccc23)n1 |
| InChI | InChI=1S/C29H20ClN9O12S4/c30-27-33-28(31)35-29(34-27)32-21-6-7-23(19-11-14(52(40,41)42)1-4-17(19)21)37-36-22-8-9-24(20-12-15(53(43,44)45)2-5-18(20)22)38-39-25-13-16(54(46,47)48)3-10-26(25)55(49,50)51/h1-13H,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,49,50,51)(H3,31,32,33,34,35)/b37-36+,39-38+ |
| InChIKey | RJCHVGOGCYBMCT-DVQJGIKISA-N |
| XLogP | 5.97 |
| TPSA | 343.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.25 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|