C23H22ClN9O11S3 — CID 165366329
4-amino-3-[[4-[[4-chloro-6-[methyl-[2-(methylamino)acetyl]amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 165366329) has the molecular formula C23H22ClN9O11S3 and a molecular weight of 732.13 g/mol. Its IUPAC name is 4-amino-3-[[4-[[4-chloro-6-[methyl-[2-(methylamino)acetyl]amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[[4-[[4-chloro-6-[methyl-[2-(methylamino)acetyl]amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 165366329 |
| Molecular Formula | C23H22ClN9O11S3 |
| Molecular Weight | 732.13 g/mol |
| Exact Mass | 731.03 |
| IUPAC Name | 4-amino-3-[[4-[[4-chloro-6-[methyl-[2-(methylamino)acetyl]amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CNCC(=O)N(C)c1nc(Cl)nc(Nc2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)cc(O)c4c3N)c(S(=O)(=O)O)c2)n1 |
| InChI | InChI=1S/C23H22ClN9O11S3/c1-26-9-17(35)33(2)23-29-21(24)28-22(30-23)27-11-3-4-13(15(7-11)46(39,40)41)31-32-20-16(47(42,43)44)6-10-5-12(45(36,37)38)8-14(34)18(10)19(20)25/h3-8,26,34H,9,25H2,1-2H3,(H,36,37,38)(H,39,40,41)(H,42,43,44)(H,27,28,29,30)/b32-31+ |
| InChIKey | VUSRMHHXWXFULF-QNEJGDQOSA-N |
| XLogP | 2.05 |
| TPSA | 317.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.13 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|