C27H19ClN8O13S4 — CID 101196418
7-[[4-[[4-chloro-6-(N-methyl-4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-isocyanatophenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid (PubChem CID 101196418) has the molecular formula C27H19ClN8O13S4 and a molecular weight of 827.21 g/mol. Its IUPAC name is 7-[[4-[[4-chloro-6-(N-methyl-4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-isocyanatophenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 7-[[4-[[4-chloro-6-(N-methyl-4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-isocyanatophenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 101196418 |
| Molecular Formula | C27H19ClN8O13S4 |
| Molecular Weight | 827.21 g/mol |
| Exact Mass | 825.96 |
| IUPAC Name | 7-[[4-[[4-chloro-6-(N-methyl-4-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-isocyanatophenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
| SMILES | CN(c1ccc(S(=O)(=O)O)cc1)c1nc(Cl)nc(Nc2ccc(/N=N/c3cc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4cc3S(=O)(=O)O)c(N=C=O)c2)n1 |
| InChI | InChI=1S/C27H19ClN8O13S4/c1-36(16-3-5-17(6-4-16)50(38,39)40)27-32-25(28)31-26(33-27)30-15-2-7-20(21(10-15)29-13-37)34-35-22-12-19-14(9-24(22)53(47,48)49)8-18(51(41,42)43)11-23(19)52(44,45)46/h2-12H,1H3,(H,38,39,40)(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,30,31,32,33)/b35-34+ |
| InChIKey | SVRKMSBXMSCPGS-XAHDOWKMSA-N |
| XLogP | 4.56 |
| TPSA | 325.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|