C29H24ClN7O5S2 — CID 90368986
7-[[4-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]-3-methylnaphthalene-1-sulfonic acid (PubChem CID 90368986) has the molecular formula C29H24ClN7O5S2 and a molecular weight of 650.14 g/mol. Its IUPAC name is 7-[[4-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]-3-methylnaphthalene-1-sulfonic acid.
| Compound Name | 7-[[4-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]-3-methylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 90368986 |
| Molecular Formula | C29H24ClN7O5S2 |
| Molecular Weight | 650.14 g/mol |
| Exact Mass | 649.10 |
| IUPAC Name | 7-[[4-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]-3-methylnaphthalene-1-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(Nc2nc(Cl)nc(Nc3ccc(/N=N/c4ccc5cc(C)cc(S(=O)(=O)O)c5c4)c(C)c3)n2)cc1 |
| InChI | InChI=1S/C29H24ClN7O5S2/c1-4-43(38,39)23-10-7-20(8-11-23)31-28-33-27(30)34-29(35-28)32-21-9-12-25(18(3)15-21)37-36-22-6-5-19-13-17(2)14-26(24(19)16-22)44(40,41)42/h4-16H,1H2,2-3H3,(H,40,41,42)(H2,31,32,33,34,35)/b37-36+ |
| InChIKey | RLEJZVNHHVFQOI-BSRQYYOTSA-N |
| XLogP | 7.36 |
| TPSA | 175.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.14 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|