C29H24ClN7O8S3 — CID 88884189
7-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-4-methyl-3-[(2-methyl-5-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 88884189) has the molecular formula C29H24ClN7O8S3 and a molecular weight of 730.21 g/mol. Its IUPAC name is 7-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-4-methyl-3-[(2-methyl-5-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-4-methyl-3-[(2-methyl-5-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 88884189 |
| Molecular Formula | C29H24ClN7O8S3 |
| Molecular Weight | 730.21 g/mol |
| Exact Mass | 729.05 |
| IUPAC Name | 7-[[4-chloro-6-(4-ethenylsulfonylanilino)-1,3,5-triazin-2-yl]amino]-4-methyl-3-[(2-methyl-5-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(Nc2nc(Cl)nc(Nc3ccc4c(C)c(/N=N/c5cc(S(=O)(=O)O)ccc5C)c(S(=O)(=O)O)cc4c3)n2)cc1 |
| InChI | InChI=1S/C29H24ClN7O8S3/c1-4-46(38,39)21-10-6-19(7-11-21)31-28-33-27(30)34-29(35-28)32-20-8-12-23-17(3)26(25(48(43,44)45)14-18(23)13-20)37-36-24-15-22(47(40,41)42)9-5-16(24)2/h4-15H,1H2,2-3H3,(H,40,41,42)(H,43,44,45)(H2,31,32,33,34,35)/b37-36+ |
| InChIKey | MNRRDDJYGBHNOB-BSRQYYOTSA-N |
| XLogP | 6.61 |
| TPSA | 230.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.21 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|